Systematic / IUPAC Name: (6R)-4-[(1-Methylindol-3-yl)methyl]-6-phenoxy-1,4-oxazepane
ID: Reference11625
Other Names: NAT47-552434
Formula: C21H24N2O2
1-Methyl-3-{[(6R)-6-phenoxy-1,4-oxazepan-4-yl]methyl}-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 290 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/2/2022 8:21:16 AM |
| InChI | InChI=1S/C21H24N2O2/c1-22-13-17(20-9-5-6-10-21(20)22)14-23-11-12-24-16-19(15-23)25-18-7-3-2-4-8-18/h2-10,13,19H,11-12,14-16H2,1H3/t19-/m1/s1 |
| InChI Key | XQASVHXFWTYIIG-LJQANCHMSA-N |
| Canonical SMILES | CN1C=C(C2=CC=CC=C21)CN3CCOCC(C3)OC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT47-552434 |