Systematic / IUPAC Name:
ID: Reference11643
Other Names: NAT26-503681
Formula: C15H26N2O3S
N-{(1S,3S)-3-[(5-Butyl-1,2-oxazol-3-yl)methyl]-2,2-dimethylcyclobutyl}methanesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 474 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/12/2022 7:13:39 AM |
| InChI | InChI=1S/C15H26N2O3S/c1-5-6-7-13-10-12(16-20-13)8-11-9-14(15(11,2)3)17-21(4,18)19/h10-11,14,17H,5-9H2,1-4H3/t11-,14+/m1/s1 |
| InChI Key | BGZPATGNTIEOGR-RISCZKNCSA-N |
| Canonical SMILES | CCCCC1=CC(=NO1)CC2CC(C2(C)C)NS(=O)(=O)C |
| CAS | |
| Splash | |
| Other Names | NAT26-503681 |