Systematic / IUPAC Name: (8aR)-7-Cyclobutyl-2-(pyridin-3-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference11660
Other Names: NAT50-556790
Formula: C16H22N4O
(8aR)-7-Cyclobutyl-2-(3-pyridinylmethyl)hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1575 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/16/2022 12:00:19 PM |
| InChI | InChI=1S/C16H22N4O/c21-16-19(10-13-3-2-6-17-9-13)12-15-11-18(7-8-20(15)16)14-4-1-5-14/h2-3,6,9,14-15H,1,4-5,7-8,10-12H2/t15-/m1/s1 |
| InChI Key | WWIWYKCRTNSVKA-OAHLLOKOSA-N |
| Canonical SMILES | C1CC(C1)N2CCN3C(C2)CN(C3=O)CC4=CN=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT50-556790 |