Systematic / IUPAC Name: [3-[[3-[(1-Methylpiperidin-4-yl)amino]oxetan-3-yl]methyl]-1,2-oxazol-5-yl]methanol
ID: Reference11682
Other Names: NAT39-500341
Formula: C14H23N3O3
[3-({3-[(1-Methyl-4-piperidinyl)amino]-3-oxetanyl}methyl)-1,2-oxazol-5-yl]methanol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 425 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/22/2022 8:42:16 AM |
| InChI | InChI=1S/C14H23N3O3/c1-17-4-2-11(3-5-17)15-14(9-19-10-14)7-12-6-13(8-18)20-16-12/h6,11,15,18H,2-5,7-10H2,1H3 |
| InChI Key | ZIEIITANRCOMCT-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCC(CC1)NC2(COC2)CC3=NOC(=C3)CO |
| CAS | |
| Splash | |
| Other Names | NAT39-500341 |