Systematic / IUPAC Name: 4-[cyclopropyl(hydroxy)methylidene]-3,5-dioxocyclohexane-1-carboxylic acid
ID: Reference1169
Other Names: Cyclohexanecarboxylic acid, 4-(cyclopropylhydroxymethylene)-3,5-dioxo-
Formula: C11H12O5
Class: Pesticides/Herbicides
Trinexapac mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 2 |
| No. of Spectra | 89 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/5/2014 9:13:35 AM |
| InChI | InChI=1S/C11H12O5/c12-7-3-6(11(15)16)4-8(13)9(7)10(14)5-1-2-5/h5-6,14H,1-4H2,(H,15,16) |
| InChI Key | DFFWZNDCNBOKDI-UHFFFAOYSA-N |
| Canonical SMILES | C1CC1C(=C2C(=O)CC(CC2=O)C(=O)O)O |
| CAS | 143294897 |
| Splash | |
| Other Names | Cyclohexanecarboxylic acid, 4-(cyclopropylhydroxymethylene)-3,5-dioxo- |
| ChemSpider | 10469309 |
| PubChem | 14371531 |
| Wikipedia | Trinexapac (DE) |