Systematic / IUPAC Name: 1-[4-[[3-[[5-(2-Methylpropyl)-1,2-oxazol-3-yl]methyl]oxetan-3-yl]amino]piperidin-1-yl]ethanone
ID: Reference11715
Other Names: NAT39-500556
Formula: C18H29N3O3
1-[4-({3-[(5-Isobutyl-1,2-oxazol-3-yl)methyl]-3-oxetanyl}amino)-1-piperidinyl]ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1390 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/6/2022 7:23:42 AM |
| InChI | InChI=1S/C18H29N3O3/c1-13(2)8-17-9-16(20-24-17)10-18(11-23-12-18)19-15-4-6-21(7-5-15)14(3)22/h9,13,15,19H,4-8,10-12H2,1-3H3 |
| InChI Key | IPYRQSUAIKHRQT-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CC1=CC(=NO1)CC2(COC2)NC3CCN(CC3)C(=O)C |
| CAS | |
| Splash | |
| Other Names | NAT39-500556 |
| ChemSpider | 29853632 |
| ChEMBL | CHEMBL3436924 |
| PubChem | 56775669 |