Systematic / IUPAC Name: (8aR)-7-(Oxan-4-yl)-2-(pyridin-2-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference11726
Other Names: NAT50-556915
Formula: C17H24N4O2
(8aR)-2-(2-Pyridinylmethyl)-7-(tetrahydro-2H-pyran-4-yl)hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 465 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/6/2022 8:50:07 AM |
| InChI | InChI=1S/C17H24N4O2/c22-17-20(11-14-3-1-2-6-18-14)13-16-12-19(7-8-21(16)17)15-4-9-23-10-5-15/h1-3,6,15-16H,4-5,7-13H2/t16-/m1/s1 |
| InChI Key | BMMFFQLHZBSYQK-MRXNPFEDSA-N |
| Canonical SMILES | C1COCCC1N2CCN3C(C2)CN(C3=O)CC4=CC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT50-556915 |
| PubChem | 75537072 |
| ChemSpider | 29856329 |
| ChEMBL | CHEMBL3437526 |