Systematic / IUPAC Name: (8aR)-7-(1H-Imidazol-2-ylmethyl)-2-(pyridin-2-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference11741
Other Names: NAT50-556928
Formula: C16H20N6O
(8aR)-7-(1H-Imidazol-2-ylmethyl)-2-(2-pyridinylmethyl)hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 320 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/12/2022 11:01:40 AM |
| InChI | InChI=1S/C16H20N6O/c23-16-21(9-13-3-1-2-4-17-13)11-14-10-20(7-8-22(14)16)12-15-18-5-6-19-15/h1-6,14H,7-12H2,(H,18,19)/t14-/m1/s1 |
| InChI Key | RCQDLJLFGRQLDN-CQSZACIVSA-N |
| Canonical SMILES | C1CN2C(CN1CC3=NC=CN3)CN(C2=O)CC4=CC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT50-556928 |