Systematic / IUPAC Name: (6R)-6-Phenoxy-4-(pyridin-2-ylmethyl)-1,4-oxazepane
ID: Reference11744
Other Names: NAT47-552427
Formula: C17H20N2O2
(6R)-6-Phenoxy-4-(2-pyridinylmethyl)-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 745 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/12/2022 11:19:41 AM |
| InChI | InChI=1S/C17H20N2O2/c1-2-7-16(8-3-1)21-17-13-19(10-11-20-14-17)12-15-6-4-5-9-18-15/h1-9,17H,10-14H2/t17-/m1/s1 |
| InChI Key | VIBVZHKYECKWQQ-QGZVFWFLSA-N |
| Canonical SMILES | C1COCC(CN1CC2=CC=CC=N2)OC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT47-552427 |