Systematic / IUPAC Name:
ID: Reference11746
Other Names: NAT47-553544
Formula: C14H19NO4
1-[(6R)-6-(4-Methoxyphenoxy)-1,4-oxazepan-4-yl]ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 710 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/12/2022 12:23:24 PM |
| InChI | InChI=1S/C14H19NO4/c1-11(16)15-7-8-18-10-14(9-15)19-13-5-3-12(17-2)4-6-13/h3-6,14H,7-10H2,1-2H3/t14-/m1/s1 |
| InChI Key | MGIKPBQCWCGFLF-CQSZACIVSA-N |
| Canonical SMILES | CC(=O)N1CCOCC(C1)OC2=CC=C(C=C2)OC |
| CAS | |
| Splash | |
| Other Names | NAT47-553544 |