Systematic / IUPAC Name: (6R)-4-[(3-Chlorophenyl)methyl]-6-pyrazin-2-yloxy-1,4-oxazepane
ID: Reference11748
Other Names: NAT47-552491
Formula: C16H18ClN3O2
(6R)-4-(3-Chlorobenzyl)-6-(2-pyrazinyloxy)-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 449 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/12/2022 2:57:55 PM |
| InChI | InChI=1S/C16H18ClN3O2/c17-14-3-1-2-13(8-14)10-20-6-7-21-12-15(11-20)22-16-9-18-4-5-19-16/h1-5,8-9,15H,6-7,10-12H2/t15-/m1/s1 |
| InChI Key | CIZYNTTZCZETPM-OAHLLOKOSA-N |
| Canonical SMILES | C1COCC(CN1CC2=CC(=CC=C2)Cl)OC3=NC=CN=C3 |
| CAS | |
| Splash | |
| Other Names | NAT47-552491 |