Systematic / IUPAC Name: (2S,6'R)-7-Chloro-2',4,6-trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione
ID: Reference1176
Other Names:
7-chloro-4,6,2'-trimethoxy-6'-methylgris-2'-en-3,4'-dione;
7-Chloro-2',4,6-trimethoxy-6'β-methylspiro(benzofuran-2(3H),1'-(2)cyclohexene)-3,4'-dione;
(+)-Griseofulvin;
Fulvicin;
Grisactin
; more
Formula: C17H17ClO6
Class: Therapeutics/Prescription Drugs Natural Toxins
Griseofulvin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap Fusion Lumos with ETD LBP FAIMS ; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 7 |
| No. of Spectra | 5171 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | IT; FT |
| Last Modification | 4/10/2018 10:42:13 AM |
| InChI | InChI=1S/C17H17ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h6-8H,5H2,1-4H3/t8-,17+/m1/s1 |
| InChI Key | DDUHZTYCFQRHIY-RBHXEPJQSA-N |
| Canonical SMILES | CC1CC(=O)C=C(C12C(=O)C3=C(O2)C(=C(C=C3OC)OC)Cl)OC |
| CAS | 126078 |
| Splash | |
| Other Names |
7-chloro-4,6,2'-trimethoxy-6'-methylgris-2'-en-3,4'-dione; 7-Chloro-2',4,6-trimethoxy-6'β-methylspiro(benzofuran-2(3H),1'-(2)cyclohexene)-3,4'-dione; (+)-Griseofulvin; Fulvicin; Grisactin; Grisovin; Spirofulvin; Amudane; Grifulvin; Lamoryl; Likuden; Fulcin; Grysio; Poncyl; Curling factor; Grizeofulvin; Grisefuline; Grisofulvin; Delmofulvina; Fulvistatin; Griscofulvin; Fulcine; Fulvinil; Fungivin; Greosin; Gresfeed; Grifulin; Griseomix; Grisetin; Guservin; Murfulvin; Gricin; Griseo; Biogrisin-FP; Neo-fulcin; Ultragris-330 |
| ChEBI | CHEBI:27779 |
| DrugBank | APRD01004 |
| HMDb | HMDB14544 |
| PubChem | 441140 |
| ChemSpider | 389934 |
| KEGG | C06686; D00209 |
| Wikipedia | Griseofulvin |
| ChEMBL | CHEMBL562 |
| ChemIDPlus | 000126078 |