Systematic / IUPAC Name: N-Cyclohexyl-3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]oxetan-3-amine
ID: Reference11765
Other Names: NAT39-500178
Formula: C15H24N2O3
N-Cyclohexyl-3-{[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl}-3-oxetanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 784 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/19/2022 10:45:34 AM |
| InChI | InChI=1S/C15H24N2O3/c1-18-9-14-7-13(17-20-14)8-15(10-19-11-15)16-12-5-3-2-4-6-12/h7,12,16H,2-6,8-11H2,1H3 |
| InChI Key | YVPGEYHHDHFBNZ-UHFFFAOYSA-N |
| Canonical SMILES | COCC1=CC(=NO1)CC2(COC2)NC3CCCCC3 |
| CAS | |
| Splash | |
| Other Names | NAT39-500178 |
| PubChem | 56775540 |
| ChemSpider | 29853506 |
| ChEMBL | CHEMBL3436925 |