Systematic / IUPAC Name: Ethyl 3-[[(3R,4S)-3-ethyl-4-[2-(naphthalen-1-ylmethylamino)-2-oxoethyl]piperidine-1-carbonyl]amino]benzoate
ID: Reference11776
Other Names: NAT14-323756
Formula: C30H35N3O4
Ethyl 3-({[(3R,4S)-3-ethyl-4-{2-[(1-naphthylmethyl)amino]-2-oxoethyl}-1-piperidinyl]carbonyl}amino)benzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1359 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/23/2022 6:16:39 AM |
| InChI | InChI=1S/C30H35N3O4/c1-3-21-20-33(30(36)32-26-13-8-11-24(17-26)29(35)37-4-2)16-15-23(21)18-28(34)31-19-25-12-7-10-22-9-5-6-14-27(22)25/h5-14,17,21,23H,3-4,15-16,18-20H2,1-2H3,(H,31,34)(H,32,36)/t21-,23-/m0/s1 |
| InChI Key | UNVYTBGILCAEMQ-GMAHTHKFSA-N |
| Canonical SMILES | CCC1CN(CCC1CC(=O)NCC2=CC=CC3=CC=CC=C32)C(=O)NC4=CC=CC(=C4)C(=O)OCC |
| CAS | |
| Splash | |
| Other Names | NAT14-323756 |