Systematic / IUPAC Name: (2S)-N-[(2S)-1-Amino-3-cyclohexyl-1-oxopropan-2-yl]-4-[4-(dimethylamino)benzoyl]-1-(thiophene-2-carbonyl)piperazine-2-carboxamide
ID: Reference11778
Other Names: NAT9-312570
Formula: C28H37N5O4S
(2S)-N-[(2S)-1-Amino-3-cyclohexyl-1-oxo-2-propanyl]-4-[4-(dimethylamino)benzoyl]-1-(2-thienylcarbonyl)-2-piperazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1225 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/23/2022 6:20:13 AM |
| InChI | InChI=1S/C28H37N5O4S/c1-31(2)21-12-10-20(11-13-21)27(36)32-14-15-33(28(37)24-9-6-16-38-24)23(18-32)26(35)30-22(25(29)34)17-19-7-4-3-5-8-19/h6,9-13,16,19,22-23H,3-5,7-8,14-15,17-18H2,1-2H3,(H2,29,34)(H,30,35)/t22-,23-/m0/s1 |
| InChI Key | LYQCLIHXPHRXQM-GOTSBHOMSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=O)N2CCN(C(C2)C(=O)NC(CC3CCCCC3)C(=O)N)C(=O)C4=CC=CS4 |
| CAS | |
| Splash | |
| Other Names | NAT9-312570 |