Systematic / IUPAC Name: 2-[(3R,4S)-1-(4-Methoxybenzoyl)-3-[2-[N-(2-morpholin-4-ylethyl)anilino]ethyl]piperidin-4-yl]acetic acid
ID: Reference11783
Other Names: NAT14-337031
Formula: C29H39N3O5
[(3R,4S)-1-(4-Methoxybenzoyl)-3-(2-{[2-(4-morpholinyl)ethyl](phenyl)amino}ethyl)-4-piperidinyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 999 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/23/2022 6:25:57 AM |
| InChI | InChI=1S/C29H39N3O5/c1-36-27-9-7-23(8-10-27)29(35)32-14-11-24(21-28(33)34)25(22-32)12-13-31(26-5-3-2-4-6-26)16-15-30-17-19-37-20-18-30/h2-10,24-25H,11-22H2,1H3,(H,33,34)/t24-,25-/m0/s1 |
| InChI Key | ZFFYITIGSLHFRK-DQEYMECFSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(=O)N2CCC(C(C2)CCN(CCN3CCOCC3)C4=CC=CC=C4)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT14-337031 |