Systematic / IUPAC Name: 2-[1-[2-[[(1S,4S,6S)-3-Methyl-4-[(1-methylbenzimidazol-2-yl)methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methylamino]-2-oxoethyl]cyclopentyl]acetic acid
ID: Reference11785
Other Names: NAT28-538618
Formula: C29H41N3O3
(1-{2-[({(1S,4S,6S)-6-Isopropyl-3-methyl-4-[(1-methyl-1H-benzimidazol-2-yl)methyl]-2-cyclohexen-1-yl}methyl)amino]-2-oxoethyl}cyclopentyl)acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1709 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/23/2022 7:41:11 AM |
| InChI | InChI=1S/C29H41N3O3/c1-19(2)23-14-21(15-26-31-24-9-5-6-10-25(24)32(26)4)20(3)13-22(23)18-30-27(33)16-29(17-28(34)35)11-7-8-12-29/h5-6,9-10,13,19,21-23H,7-8,11-12,14-18H2,1-4H3,(H,30,33)(H,34,35)/t21-,22-,23-/m0/s1 |
| InChI Key | YMRPSGLKDQJZBD-VABKMULXSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NC3=CC=CC=C3N2C)C(C)C)CNC(=O)CC4(CCCC4)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT28-538618 |