Systematic / IUPAC Name: 2-(4-Methoxyphenyl)-5-[[(1S,4S,5S)-2-methyl-5-propan-2-yl-4-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]cyclohex-2-en-1-yl]methyl]-1,3,4-oxadiazole
ID: Reference11800
Other Names: NAT28-412326
Formula: C29H38N6O2
2-(4-{[(1S,4S,6S)-6-Isopropyl-4-{[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl}-3-methyl-2-cyclohexen-1-yl]methyl}-1-piperazinyl)pyrazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1054 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/30/2022 7:56:23 AM |
| InChI | InChI=1S/C29H38N6O2/c1-20(2)26-16-23(17-28-32-33-29(37-28)22-5-7-25(36-4)8-6-22)21(3)15-24(26)19-34-11-13-35(14-12-34)27-18-30-9-10-31-27/h5-10,15,18,20,23-24,26H,11-14,16-17,19H2,1-4H3/t23-,24-,26-/m0/s1 |
| InChI Key | OIANBRMCEAZYDJ-GNKBHMEESA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CC=C(C=C3)OC)C(C)C)CN4CCN(CC4)C5=NC=CN=C5 |
| CAS | |
| Splash | |
| Other Names | NAT28-412326 |