Systematic / IUPAC Name: N-[[(2R,4S,5S)-5-[(4-Benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiophene-2-sulfonamide
ID: Reference11802
Other Names: NAT13-339545
Formula: C25H35N3O2S2
N-({(2R,4S,5S)-5-[(4-Benzyl-1-piperidinyl)methyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)-2-thiophenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1263 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/30/2022 7:59:36 AM |
| InChI | InChI=1S/C25H35N3O2S2/c29-32(30,25-7-4-14-31-25)26-17-24-16-22-10-13-28(24)19-23(22)18-27-11-8-21(9-12-27)15-20-5-2-1-3-6-20/h1-7,14,21-24,26H,8-13,15-19H2/t22-,23-,24+/m0/s1 |
| InChI Key | ROKRHGAQIAKBKT-KMDXXIMOSA-N |
| Canonical SMILES | C1CN(CCC1CC2=CC=CC=C2)CC3CN4CCC3CC4CNS(=O)(=O)C5=CC=CS5 |
| CAS | |
| Splash | |
| Other Names | NAT13-339545 |