Systematic / IUPAC Name: 2-[2-Oxo-2-[[(2R,4S,5R)-5-(6-pentan-3-yl-2-pyridin-4-ylpyrimidin-4-yl)-1-azabicyclo[2.2.2]octan-2-yl]methylamino]ethyl]sulfanylacetic acid
ID: Reference11804
Other Names: NAT13-341645
Formula: C26H35N5O3S
({2-Oxo-2-[({(2R,4S,5R)-5-[6-(3-pentanyl)-2-(4-pyridinyl)-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)amino]ethyl}sulfanyl)acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3055 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/30/2022 8:10:18 AM |
| InChI | InChI=1S/C26H35N5O3S/c1-3-17(4-2)22-12-23(30-26(29-22)18-5-8-27-9-6-18)21-14-31-10-7-19(21)11-20(31)13-28-24(32)15-35-16-25(33)34/h5-6,8-9,12,17,19-21H,3-4,7,10-11,13-16H2,1-2H3,(H,28,32)(H,33,34)/t19-,20+,21-/m0/s1 |
| InChI Key | ZPCSZYGSFPSWSJ-HBMCJLEFSA-N |
| Canonical SMILES | CCC(CC)C1=NC(=NC(=C1)C2CN3CCC2CC3CNC(=O)CSCC(=O)O)C4=CC=NC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT13-341645 |