Systematic / IUPAC Name: 3-[3-[[3-(Benzylamino)oxetan-3-yl]methyl]-1,2-oxazol-5-yl]phenol
ID: Reference11811
Other Names: NAT39-500656
Formula: C20H20N2O3
3-(3-{[3-(Benzylamino)-3-oxetanyl]methyl}-1,2-oxazol-5-yl)phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 995 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/3/2022 11:45:06 AM |
| InChI | InChI=1S/C20H20N2O3/c23-18-8-4-7-16(9-18)19-10-17(22-25-19)11-20(13-24-14-20)21-12-15-5-2-1-3-6-15/h1-10,21,23H,11-14H2 |
| InChI Key | ONULJROEXLODDY-UHFFFAOYSA-N |
| Canonical SMILES | C1C(CO1)(CC2=NOC(=C2)C3=CC(=CC=C3)O)NCC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT39-500656 |