Systematic / IUPAC Name: (8aR)-2-Methyl-7-(1,3-thiazol-2-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference11819
Other Names: NAT50-557225
Formula: C11H16N4OS
(8aR)-2-Methyl-7-(1,3-thiazol-2-ylmethyl)hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 609 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/3/2022 12:17:00 PM |
| InChI | InChI=1S/C11H16N4OS/c1-13-6-9-7-14(3-4-15(9)11(13)16)8-10-12-2-5-17-10/h2,5,9H,3-4,6-8H2,1H3/t9-/m0/s1 |
| InChI Key | SQSHJWBBAVWLDA-VIFPVBQESA-N |
| Canonical SMILES | CN1CC2CN(CCN2C1=O)CC3=NC=CS3 |
| CAS | |
| Splash | |
| Other Names | NAT50-557225 |