Systematic / IUPAC Name: Dodecanedioic acid
ID: Reference1182
Other Names:
1,12-Dodecanedioic acid;
1,10-Decanedicarboxylic acid;
1,10-Dicarboxydecane;
Decane-1,10-dicarboxylic acid;
n-Dodecanedioate
; more
Formula: C12H22O4
Class: Endogenous Metabolites
Dodecanedioic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 168 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/17/2016 7:12:02 AM |
| InChI | InChI=1S/C12H22O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1-10H2,(H,13,14)(H,15,16) |
| InChI Key | TVIDDXQYHWJXFK-UHFFFAOYSA-N |
| Canonical SMILES | C(CCCCCC(=O)O)CCCCC(=O)O |
| CAS | 693232 |
| Splash | |
| Other Names |
1,12-Dodecanedioic acid; 1,10-Decanedicarboxylic acid; 1,10-Dicarboxydecane; Decane-1,10-dicarboxylic acid; n-Dodecanedioate; n-Dodecanedioic acid; 1,12-Dodecanedioate |
| ChemIDPlus | 000693232; 035464949; 013188608; 026098555; 031352393; 036497344; 060180781; 084434866 |
| LipidsMAPs | LMFA01170009 |
| KEGG | C02678 |
| HMDb | HMDB00623 |
| ChemSpider | 12213 |
| PubChem | 12736 |
| ChEBI | CHEBI:4676 |
| Wikipedia | Dodecanedioic acid |