Systematic / IUPAC Name: 3-[[5-(4-Fluorophenyl)-1,2-oxazol-3-yl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]oxetan-3-amine
ID: Reference11831
Other Names: NAT39-500070
Formula: C21H18F4N2O3
3-{[5-(4-Fluorophenyl)-1,2-oxazol-3-yl]methyl}-N-[4-(trifluoromethoxy)benzyl]-3-oxetanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 665 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/10/2022 12:24:46 PM |
| InChI | InChI=1S/C21H18F4N2O3/c22-16-5-3-15(4-6-16)19-9-17(27-30-19)10-20(12-28-13-20)26-11-14-1-7-18(8-2-14)29-21(23,24)25/h1-9,26H,10-13H2 |
| InChI Key | JZFRBEXDWPLGRK-UHFFFAOYSA-N |
| Canonical SMILES | C1C(CO1)(CC2=NOC(=C2)C3=CC=C(C=C3)F)NCC4=CC=C(C=C4)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT39-500070 |