Systematic / IUPAC Name: 2-[1-[2-[[(1S,4S,6S)-4-[(6-Methoxycarbonyl-1H-benzimidazol-2-yl)methyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methylamino]-2-oxoethyl]cyclopentyl]acetic acid
ID: Reference11847
Other Names: NAT28-553891
Formula: C30H41N3O5
{1-[2-({[(1S,4S,6S)-6-Isopropyl-4-{[5-(methoxycarbonyl)-1H-benzimidazol-2-yl]methyl}-3-methyl-2-cyclohexen-1-yl]methyl}amino)-2-oxoethyl]cyclopentyl}acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2275 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2022 10:26:19 AM |
| InChI | InChI=1S/C30H41N3O5/c1-18(2)23-12-21(14-26-32-24-8-7-20(29(37)38-4)13-25(24)33-26)19(3)11-22(23)17-31-27(34)15-30(16-28(35)36)9-5-6-10-30/h7-8,11,13,18,21-23H,5-6,9-10,12,14-17H2,1-4H3,(H,31,34)(H,32,33)(H,35,36)/t21-,22-,23-/m0/s1 |
| InChI Key | VKJOMQVTJJEOHN-VABKMULXSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NC3=C(N2)C=C(C=C3)C(=O)OC)C(C)C)CNC(=O)CC4(CCCC4)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT28-553891 |