Systematic / IUPAC Name: (3R,4S,6R)-6-[[4-[[Benzyl(methyl)amino]methyl]triazol-1-yl]methyl]-N-(furan-2-ylmethyl)-1-azabicyclo[2.2.2]octane-3-carboxamide
ID: Reference11849
Other Names: NAT13-329031
Formula: C25H32N6O2
(3R,4S,6R)-6-[(4-{[Benzyl(methyl)amino]methyl}-1H-1,2,3-triazol-1-yl)methyl]-N-(2-furylmethyl)quinuclidine-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1950 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2022 11:17:36 AM |
| InChI | InChI=1S/C25H32N6O2/c1-29(14-19-6-3-2-4-7-19)15-21-16-31(28-27-21)17-22-12-20-9-10-30(22)18-24(20)25(32)26-13-23-8-5-11-33-23/h2-8,11,16,20,22,24H,9-10,12-15,17-18H2,1H3,(H,26,32)/t20-,22+,24-/m0/s1 |
| InChI Key | HRNAZPCXZKSTOP-FJIJXJHWSA-N |
| Canonical SMILES | CN(CC1=CC=CC=C1)CC2=CN(N=N2)CC3CC4CCN3CC4C(=O)NCC5=CC=CO5 |
| CAS | |
| Splash | |
| Other Names | NAT13-329031 |