Systematic / IUPAC Name: 1-[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl]-N-[(4-phenylphenyl)methyl]methanamine
ID: Reference11850
Other Names: NAT13-337453
Formula: C23H30N2
1-(4-Biphenylyl)-N-{[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl}methanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 305 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2022 11:18:16 AM |
| InChI | InChI=1S/C23H30N2/c1-2-19-17-25-13-12-22(19)14-23(25)16-24-15-18-8-10-21(11-9-18)20-6-4-3-5-7-20/h3-11,19,22-24H,2,12-17H2,1H3/t19-,22-,23+/m0/s1 |
| InChI Key | RTPVGQWZNXAHQL-AJSBUHFISA-N |
| Canonical SMILES | CCC1CN2CCC1CC2CNCC3=CC=C(C=C3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT13-337453 |