Systematic / IUPAC Name: 1-[4-[(2S)-2-[3-(2-Pyrrolidin-1-ylpyridin-4-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]piperidin-1-yl]ethanone
ID: Reference11852
Other Names: NAT18-473599
Formula: C22H30N6O2
1-{4-[(2S)-2-{3-[2-(1-Pyrrolidinyl)-4-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]-1-piperidinyl}ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 420 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2022 11:20:15 AM |
| InChI | InChI=1S/C22H30N6O2/c1-16(29)26-13-7-18(8-14-26)28-12-4-5-19(28)22-24-21(25-30-22)17-6-9-23-20(15-17)27-10-2-3-11-27/h6,9,15,18-19H,2-5,7-8,10-14H2,1H3/t19-/m0/s1 |
| InChI Key | WBUAGFMZIDYEBJ-IBGZPJMESA-N |
| Canonical SMILES | CC(=O)N1CCC(CC1)N2CCCC2C3=NC(=NO3)C4=CC(=NC=C4)N5CCCC5 |
| CAS | |
| Splash | |
| Other Names | NAT18-473599 |