Systematic / IUPAC Name: 2-[(3S)-1-[(3,4-Difluorophenyl)methyl]pyrrolidin-3-yl]-3H-benzimidazole-5-carbonitrile
ID: Reference11854
Other Names: NAT31-457735
Formula: C19H16F2N4
2-[(3S)-1-(3,4-Difluorobenzyl)-3-pyrrolidinyl]-1H-benzimidazole-5-carbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 779 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2022 11:24:27 AM |
| InChI | InChI=1S/C19H16F2N4/c20-15-3-1-13(7-16(15)21)10-25-6-5-14(11-25)19-23-17-4-2-12(9-22)8-18(17)24-19/h1-4,7-8,14H,5-6,10-11H2,(H,23,24)/t14-/m0/s1 |
| InChI Key | VEIRQEYHSPVZJZ-AWEZNQCLSA-N |
| Canonical SMILES | C1CN(CC1C2=NC3=C(N2)C=C(C=C3)C#N)CC4=CC(=C(C=C4)F)F |
| CAS | |
| Splash | |
| Other Names | NAT31-457735 |