Systematic / IUPAC Name: (3,4-Dimethoxyphenyl)-[(3S)-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methanone
ID: Reference11864
Other Names: NAT31-462525
Formula: C16H19N3O4
(3,4-Dimethoxyphenyl)[(3S)-3-(5-methyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl]methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 465 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/17/2022 8:58:34 AM |
| InChI | InChI=1S/C16H19N3O4/c1-10-17-18-15(23-10)12-6-7-19(9-12)16(20)11-4-5-13(21-2)14(8-11)22-3/h4-5,8,12H,6-7,9H2,1-3H3/t12-/m0/s1 |
| InChI Key | LSTMSYXTTAMICB-LBPRGKRZSA-N |
| Canonical SMILES | CC1=NN=C(O1)C2CCN(C2)C(=O)C3=CC(=C(C=C3)OC)OC |
| CAS | |
| Splash | |
| Other Names | NAT31-462525 |