Systematic / IUPAC Name: N-[4-[(R)-Hydroxy-[(3R)-4-(1H-imidazol-2-ylmethyl)-5-oxomorpholin-3-yl]methyl]phenyl]cyclopropanecarboxamide
ID: Reference11869
Other Names: NAT36-505086
Formula: C19H22N4O4
N-(4-{(R)-Hydroxy[(3R)-4-(1H-imidazol-2-ylmethyl)-5-oxo-3-morpholinyl]methyl}phenyl)cyclopropanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1045 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/17/2022 10:43:29 AM |
| InChI | InChI=1S/C19H22N4O4/c24-17-11-27-10-15(23(17)9-16-20-7-8-21-16)18(25)12-3-5-14(6-4-12)22-19(26)13-1-2-13/h3-8,13,15,18,25H,1-2,9-11H2,(H,20,21)(H,22,26)/t15-,18-/m1/s1 |
| InChI Key | UFUHQOATEMJQHO-CRAIPNDOSA-N |
| Canonical SMILES | C1CC1C(=O)NC2=CC=C(C=C2)C(C3COCC(=O)N3CC4=NC=CN4)O |
| CAS | |
| Splash | |
| Other Names | NAT36-505086 |