Systematic / IUPAC Name: N-[4-[(R)-Hydroxy-[(3R)-4-methyl-5-oxomorpholin-3-yl]methyl]phenyl]pyridine-3-carboxamide
ID: Reference11870
Other Names: NAT36-509543
Formula: C18H19N3O4
N-(4-{(R)-Hydroxy[(3R)-4-methyl-5-oxo-3-morpholinyl]methyl}phenyl)nicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1080 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/17/2022 10:46:05 AM |
| InChI | InChI=1S/C18H19N3O4/c1-21-15(10-25-11-16(21)22)17(23)12-4-6-14(7-5-12)20-18(24)13-3-2-8-19-9-13/h2-9,15,17,23H,10-11H2,1H3,(H,20,24)/t15-,17-/m1/s1 |
| InChI Key | BMXUYUWHWBTJEE-NVXWUHKLSA-N |
| Canonical SMILES | CN1C(COCC1=O)C(C2=CC=C(C=C2)NC(=O)C3=CN=CC=C3)O |
| CAS | |
| Splash | |
| Other Names | NAT36-509543 |