Systematic / IUPAC Name: 1-[4-[4-[5-[(2S)-1-[[3-(Trifluoromethoxy)phenyl]methyl]pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-yl]piperazin-1-yl]ethanone
ID: Reference11876
Other Names: NAT18-428453
Formula: C25H27F3N6O3
1-{4-[4-(5-{(2S)-1-[3-(Trifluoromethoxy)benzyl]-2-pyrrolidinyl}-1,2,4-oxadiazol-3-yl)-2-pyridinyl]-1-piperazinyl}ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 720 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/21/2022 8:10:06 AM |
| InChI | InChI=1S/C25H27F3N6O3/c1-17(35)32-10-12-33(13-11-32)22-15-19(7-8-29-22)23-30-24(37-31-23)21-6-3-9-34(21)16-18-4-2-5-20(14-18)36-25(26,27)28/h2,4-5,7-8,14-15,21H,3,6,9-13,16H2,1H3/t21-/m0/s1 |
| InChI Key | FQIXGUACWVJMAN-NRFANRHFSA-N |
| Canonical SMILES | CC(=O)N1CCN(CC1)C2=NC=CC(=C2)C3=NOC(=N3)C4CCCN4CC5=CC(=CC=C5)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT18-428453 |