Systematic / IUPAC Name:
ID: Reference11878
Other Names: NAT26-505555
Formula: C25H29N3O3
1-Benzyl-3-[(1S,3S)-2,2-dimethyl-3-{[5-(phenoxymethyl)-1,2-oxazol-3-yl]methyl}cyclobutyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1094 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/21/2022 8:12:29 AM |
| InChI | InChI=1S/C25H29N3O3/c1-25(2)19(14-23(25)27-24(29)26-16-18-9-5-3-6-10-18)13-20-15-22(31-28-20)17-30-21-11-7-4-8-12-21/h3-12,15,19,23H,13-14,16-17H2,1-2H3,(H2,26,27,29)/t19-,23+/m1/s1 |
| InChI Key | ABPGKHXCSTVPIG-XXBNENTESA-N |
| Canonical SMILES | CC1(C(CC1NC(=O)NCC2=CC=CC=C2)CC3=NOC(=C3)COC4=CC=CC=C4)C |
| CAS | |
| Splash | |
| Other Names | NAT26-505555 |