Systematic / IUPAC Name: 2-Ethylpropanedioic acid
ID: Reference1188
Other Names:
2-Ethylmalonic acid;
Propanedioic acid, ethyl-;
1,1-Propanedicarboxylic acid;
Ethylmalonate;
Ethylpropanedioic acid
; more
Formula: C5H8O4
Class: Industrial Chemicals Endogenous Metabolites
Ethylmalonic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 199 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/17/2016 7:14:34 AM |
| InChI | InChI=1S/C5H8O4/c1-2-3(4(6)7)5(8)9/h3H,2H2,1H3,(H,6,7)(H,8,9) |
| InChI Key | UKFXDFUAPNAMPJ-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C(=O)O)C(=O)O |
| CAS | 601752 |
| Splash | |
| Other Names |
2-Ethylmalonic acid; Propanedioic acid, ethyl-; 1,1-Propanedicarboxylic acid; Ethylmalonate; Ethylpropanedioic acid; Malonic acid, ethyl-; Ethyl malonic acid; 1,1-Propanedicarboxylate; α-Carboxybutyric acid; α-Carboxybutyrate |
| ChemIDPlus | 000601752 |
| HMDb | HMDB00622 |
| ChEBI | CHEBI:741548 |
| PubChem | 11756 |
| ChemSpider | 11263 |
| ChEMBL | CHEMBL1160009 |