Systematic / IUPAC Name: (3R)-3-(5-tert-Butyl-1H-imidazol-2-yl)-4-methylmorpholine
ID: Reference11881
Other Names: NAT41-530719
Formula: C12H21N3O
(3R)-4-Methyl-3-[4-(2-methyl-2-propanyl)-1H-imidazol-2-yl]morpholine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 525 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/21/2022 8:16:04 AM |
| InChI | InChI=1S/C12H21N3O/c1-12(2,3)10-7-13-11(14-10)9-8-16-6-5-15(9)4/h7,9H,5-6,8H2,1-4H3,(H,13,14)/t9-/m0/s1 |
| InChI Key | FISDVPVNJWWWDU-VIFPVBQESA-N |
| Canonical SMILES | CC(C)(C)C1=CN=C(N1)C2COCCN2C |
| CAS | |
| Splash | |
| Other Names | NAT41-530719 |
| ChEMBL | CHEMBL3436967 |
| ChemSpider | 29854530 |
| PubChem | 75536200 |