Systematic / IUPAC Name: 3,3-Dimethyl-5-oxo-5-[(6S)-6-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]pentanoic acid
ID: Reference11887
Other Names: NAT22-366511
Formula: C20H22N6O4
3,3-Dimethyl-5-oxo-5-{(6S)-6-[3-(4-pyridinyl)-1,2,4-oxadiazol-5-yl]-1,4,6,7-tetrahydro-5H-imidazo[4,5-c]pyridin-5-yl}pentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2072 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/31/2022 11:44:28 AM |
| InChI | InChI=1S/C20H22N6O4/c1-20(2,9-17(28)29)8-16(27)26-10-14-13(22-11-23-14)7-15(26)19-24-18(25-30-19)12-3-5-21-6-4-12/h3-6,11,15H,7-10H2,1-2H3,(H,22,23)(H,28,29)/t15-/m0/s1 |
| InChI Key | BOQIHBGLAJGBMU-HNNXBMFYSA-N |
| Canonical SMILES | CC(C)(CC(=O)N1CC2=C(CC1C3=NC(=NO3)C4=CC=NC=C4)N=CN2)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT22-366511 |