Systematic / IUPAC Name: 2-Methyl-1,3-cyclohexanedione
ID: Reference1189
Other Names:
1,3-Dimethylcycloadipic ketone;
1,3-Cyclohexanedione, 2-methyl-
Formula: C7H10O2
2-Methylcyclohexan-1,3-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 77 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/21/2015 2:01:37 PM |
| InChI | InChI=1S/C7H10O2/c1-5-6(8)3-2-4-7(5)9/h5H,2-4H2,1H3 |
| InChI Key | VSGJHHIAMHUZKF-UHFFFAOYSA-N |
| Canonical SMILES | CC1C(=O)CCCC1=O |
| CAS | 1193551 |
| Splash | |
| Other Names |
1,3-Dimethylcycloadipic ketone; 1,3-Cyclohexanedione, 2-methyl- |
| PubChem | 70945 |
| ChemSpider | 64107 |
| ChEMBL | CHEMBL191688 |
| ChemIDPlus | 001193551 |