Systematic / IUPAC Name: N-[(1S,2S,4aS,8S,8aS)-8-Hydroxy-7-[(2S)-1-[(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide
ID: Reference11891
Other Names: NAT5-396551
Formula: C31H42N2O5
N-[(1S,2S,8S,8aS)-8-Hydroxy-7-{(2S)-1-[(2-methoxybenzyl)amino]-1-oxo-2-propanyl}-1,4a-dimethyldecahydro-2-naphthalenyl]-4-methoxybenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2807 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/31/2022 11:58:50 AM |
| InChI | InChI=1S/C31H42N2O5/c1-19(29(35)32-18-22-8-6-7-9-26(22)38-5)24-14-16-31(3)17-15-25(20(2)27(31)28(24)34)33-30(36)21-10-12-23(37-4)13-11-21/h6-13,19-20,24-25,27-28,34H,14-18H2,1-5H3,(H,32,35)(H,33,36)/t19-,20+,24?,25-,27+,28-,31-/m0/s1 |
| InChI Key | UZINJEFTKXRZEG-JQPZITGGSA-N |
| Canonical SMILES | CC1C(CCC2(C1C(C(CC2)C(C)C(=O)NCC3=CC=CC=C3OC)O)C)NC(=O)C4=CC=C(C=C4)OC |
| CAS | |
| Splash | |
| Other Names | NAT5-396551 |