Systematic / IUPAC Name: 3-Benzyl-5-[(6S)-5-[(4-fluorophenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazole
ID: Reference11895
Other Names: NAT22-365352
Formula: C22H20FN5O
(6S)-6-(3-Benzyl-1,2,4-oxadiazol-5-yl)-5-(4-fluorobenzyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 595 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/31/2022 12:26:59 PM |
| InChI | InChI=1S/C22H20FN5O/c23-17-8-6-16(7-9-17)12-28-13-19-18(24-14-25-19)11-20(28)22-26-21(27-29-22)10-15-4-2-1-3-5-15/h1-9,14,20H,10-13H2,(H,24,25)/t20-/m0/s1 |
| InChI Key | CWEBHIBVAPMEJR-FQEVSTJZSA-N |
| Canonical SMILES | C1C(N(CC2=C1N=CN2)CC3=CC=C(C=C3)F)C4=NC(=NO4)CC5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names | NAT22-365352 |