Systematic / IUPAC Name: Pyrazin-2-yl-[(3S)-3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methanone
ID: Reference11906
Other Names: NAT31-467690
Formula: C16H14N6O2
2-Pyrazinyl{(3S)-3-[5-(3-pyridinyl)-1,3,4-oxadiazol-2-yl]-1-pyrrolidinyl}methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1429 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/2/2022 9:25:49 AM |
| InChI | InChI=1S/C16H14N6O2/c23-16(13-9-18-5-6-19-13)22-7-3-12(10-22)15-21-20-14(24-15)11-2-1-4-17-8-11/h1-2,4-6,8-9,12H,3,7,10H2/t12-/m0/s1 |
| InChI Key | IPWHHFXGOKOKGN-LBPRGKRZSA-N |
| Canonical SMILES | C1CN(CC1C2=NN=C(O2)C3=CN=CC=C3)C(=O)C4=NC=CN=C4 |
| CAS | |
| Splash | |
| Other Names | NAT31-467690 |