Systematic / IUPAC Name: 1-[4-[(2S)-2-[3-(6-Morpholin-4-ylpyridin-3-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]piperidin-1-yl]ethanone
ID: Reference11934
Other Names: NAT18-432339
Formula: C22H30N6O3
1-{4-[(2S)-2-{3-[6-(4-Morpholinyl)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]-1-piperidinyl}ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 885 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/7/2022 1:10:27 PM |
| InChI | InChI=1S/C22H30N6O3/c1-16(29)26-9-6-18(7-10-26)28-8-2-3-19(28)22-24-21(25-31-22)17-4-5-20(23-15-17)27-11-13-30-14-12-27/h4-5,15,18-19H,2-3,6-14H2,1H3/t19-/m0/s1 |
| InChI Key | LVAAVEUHKROKKP-IBGZPJMESA-N |
| Canonical SMILES | CC(=O)N1CCC(CC1)N2CCCC2C3=NC(=NO3)C4=CN=C(C=C4)N5CCOCC5 |
| CAS | |
| Splash | |
| Other Names | NAT18-432339 |