Systematic / IUPAC Name: N-(2-Methoxyethyl)-3-[5-[(2S)-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-amine
ID: Reference11951
Other Names: NAT18-429856
Formula: C20H30N6O2
N-(2-Methoxyethyl)-3-{5-[(2S)-1-(1-methyl-4-piperidinyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 624 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/14/2022 3:29:46 PM |
| InChI | InChI=1S/C20H30N6O2/c1-25-12-7-15(8-13-25)26-11-4-6-17(26)20-23-19(24-28-20)16-5-3-9-21-18(16)22-10-14-27-2/h3,5,9,15,17H,4,6-8,10-14H2,1-2H3,(H,21,22)/t17-/m0/s1 |
| InChI Key | YWXNZXPKZCREGV-KRWDZBQOSA-N |
| Canonical SMILES | CN1CCC(CC1)N2CCCC2C3=NC(=NO3)C4=C(N=CC=C4)NCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-429856 |