Systematic / IUPAC Name: [(6R)-6-Methoxy-1,4-oxazepan-4-yl]-pyridin-3-ylmethanone
ID: Reference11956
Other Names: NAT47-552139
Formula: C12H16N2O3
[(6R)-6-Methoxy-1,4-oxazepan-4-yl](3-pyridinyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 860 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/14/2022 3:55:57 PM |
| InChI | InChI=1S/C12H16N2O3/c1-16-11-8-14(5-6-17-9-11)12(15)10-3-2-4-13-7-10/h2-4,7,11H,5-6,8-9H2,1H3/t11-/m1/s1 |
| InChI Key | CTIDRSPCCGBRSC-LLVKDONJSA-N |
| Canonical SMILES | COC1CN(CCOC1)C(=O)C2=CN=CC=C2 |
| CAS | |
| Splash | |
| Other Names | NAT47-552139 |