Systematic / IUPAC Name: (8aR)-2-Methyl-7-[(1-methylimidazol-2-yl)methyl]-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference11958
Other Names: NAT50-557219
Formula: C12H19N5O
(8aR)-2-Methyl-7-[(1-methyl-1H-imidazol-2-yl)methyl]hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 260 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/14/2022 4:12:29 PM |
| InChI | InChI=1S/C12H19N5O/c1-14-4-3-13-11(14)9-16-5-6-17-10(8-16)7-15(2)12(17)18/h3-4,10H,5-9H2,1-2H3/t10-/m0/s1 |
| InChI Key | ATDVUIDVSYGZJX-JTQLQIEISA-N |
| Canonical SMILES | CN1CC2CN(CCN2C1=O)CC3=NC=CN3C |
| CAS | |
| Splash | |
| Other Names | NAT50-557219 |