Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[Bis(pyridin-2-ylmethyl)amino]-3-hydroxyoxolan-2-yl]methyl]cyclopropanecarboxamide
ID: Reference11968
Other Names:
D-Arabinitol, 1,4-anhydro-2-[bis(2-pyridinylmethyl)amino]-5-[(cyclopropylcarbonyl)amino]-2,5-dideoxy-;
NAT19-346714
Formula: C21H26N4O3
1,4-Anhydro-2-[bis(2-pyridinylmethyl)amino]-5-[(cyclopropylcarbonyl)amino]-2,5-dideoxy-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 930 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/16/2022 10:35:01 AM |
| InChI | InChI=1S/C21H26N4O3/c26-20-18(14-28-19(20)11-24-21(27)15-7-8-15)25(12-16-5-1-3-9-22-16)13-17-6-2-4-10-23-17/h1-6,9-10,15,18-20,26H,7-8,11-14H2,(H,24,27)/t18-,19-,20+/m1/s1 |
| InChI Key | WCGQVYRAADHORH-AQNXPRMDSA-N |
| Canonical SMILES | C1CC1C(=O)NCC2C(C(CO2)N(CC3=CC=CC=N3)CC4=CC=CC=N4)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2-[bis(2-pyridinylmethyl)amino]-5-[(cyclopropylcarbonyl)amino]-2,5-dideoxy-; NAT19-346714 |