Systematic / IUPAC Name: (8aR)-7-Methyl-2-(pyridin-2-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference11970
Other Names: NAT50-556907
Formula: C13H18N4O
(8aR)-7-Methyl-2-(2-pyridinylmethyl)hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 180 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/16/2022 10:37:20 AM |
| InChI | InChI=1S/C13H18N4O/c1-15-6-7-17-12(9-15)10-16(13(17)18)8-11-4-2-3-5-14-11/h2-5,12H,6-10H2,1H3/t12-/m1/s1 |
| InChI Key | RZKZLUGRYPGMEX-GFCCVEGCSA-N |
| Canonical SMILES | CN1CCN2C(C1)CN(C2=O)CC3=CC=CC=N3 |
| CAS | |
| Splash | |
| Other Names | NAT50-556907 |