Systematic / IUPAC Name: {[(2R,3S,5R)-5-(2,4-Dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl} phosphonophosphate
ID: Reference1198
Other Names:
2'-Deoxy-UTP;
Deoxyuridine triphosphate;
dUTP;
Uridine, 2'-deoxy-, 5'-triphosphate;
2,4(1H,3H)-Pyrimidinedione, 1-[2-deoxy-5-O-(hydroxy{[hydroxy(phosphonooxy)phosphinyl]oxy}phosphinyl)-β-D-erythro-pentofuranosyl]-
Formula: C9H15N2O14P3
Class: Endogenous Metabolites
2'-Deoxyuridine-5'-triphosphate (dUTP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 173 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/17/2016 8:28:21 AM |
| InChI | InChI=1S/C9H15N2O14P3/c12-5-3-8(11-2-1-7(13)10-9(11)14)23-6(5)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,18,19)(H,20,21)(H,10,13,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
| InChI Key | AHCYMLUZIRLXAA-SHYZEUOFSA-N |
| Canonical SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OCC2OC(N\1C(=O)NC(=O)/C=C/1)CC2O |
| CAS | 1173826 |
| Splash | |
| Other Names |
2'-Deoxy-UTP; Deoxyuridine triphosphate; dUTP; Uridine, 2'-deoxy-, 5'-triphosphate; 2,4(1H,3H)-Pyrimidinedione, 1-[2-deoxy-5-O-(hydroxy{[hydroxy(phosphonooxy)phosphinyl]oxy}phosphinyl)-β-D-erythro-pentofuranosyl]- |
| ChEBI | CHEBI:17625 |
| ChEMBL | CHEMBL374361 |
| HMDb | HMDB01191 |
| KEGG | C00460 |
| ChemIDPlus | 001173826; 091918342; 102814084 |
| PubChem | 65070 |
| ChemSpider | 58580 |