Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(4-Acetamidophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]-4-fluorobenzamide
ID: Reference11984
Other Names:
D-Arabinitol, 2-[[[4-(acetylamino)phenyl]methyl]amino]-1,4-anhydro-2,5-dideoxy-5-[(4-fluorobenzoyl)amino]-;
NAT19-551472
Formula: C21H24FN3O4
2-[(4-Acetamidobenzyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(4-fluorobenzoyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1400 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2022 4:17:10 PM |
| InChI | InChI=1S/C21H24FN3O4/c1-13(26)25-17-8-2-14(3-9-17)10-23-18-12-29-19(20(18)27)11-24-21(28)15-4-6-16(22)7-5-15/h2-9,18-20,23,27H,10-12H2,1H3,(H,24,28)(H,25,26)/t18-,19-,20+/m1/s1 |
| InChI Key | XCEVCYACNXQUHI-AQNXPRMDSA-N |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)CNC2COC(C2O)CNC(=O)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 2-[[[4-(acetylamino)phenyl]methyl]amino]-1,4-anhydro-2,5-dideoxy-5-[(4-fluorobenzoyl)amino]-; NAT19-551472 |