Systematic / IUPAC Name: 1-[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanamine
ID: Reference12000
Other Names: NAT13-337431
Formula: C18H25F3N2O
1-[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]oct-2-yl]-N-[4-(trifluoromethoxy)benzyl]methanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 590 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/28/2022 4:32:50 PM |
| InChI | InChI=1S/C18H25F3N2O/c1-2-14-12-23-8-7-15(14)9-16(23)11-22-10-13-3-5-17(6-4-13)24-18(19,20)21/h3-6,14-16,22H,2,7-12H2,1H3/t14-,15-,16+/m0/s1 |
| InChI Key | NVHZDUYRDNEKQQ-HRCADAONSA-N |
| Canonical SMILES | CCC1CN2CCC1CC2CNCC3=CC=C(C=C3)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT13-337431 |
| ChemSpider | 21381082 |
| ChEMBL | CHEMBL3437224 |
| PubChem | 44716348 |